C20H20O6 — CID 46702268
[3,5-dimethoxy-2-[(E)-3-(4-methoxyphenyl)(1,2,3-13C3)prop-2-enoyl]phenyl] acetate (PubChem CID 46702268) has the molecular formula C20H20O6 and a molecular weight of 359.35 g/mol. Its IUPAC name is [3,5-dimethoxy-2-[(E)-3-(4-methoxyphenyl)(1,2,3-13C3)prop-2-enoyl]phenyl] acetate.
| Compound Name | [3,5-dimethoxy-2-[(E)-3-(4-methoxyphenyl)(1,2,3-13C3)prop-2-enoyl]phenyl] acetate |
|---|---|
| PubChem CID | 46702268 |
| Molecular Formula | C20H20O6 |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | [3,5-dimethoxy-2-[(E)-3-(4-methoxyphenyl)(1,2,3-13C3)prop-2-enoyl]phenyl] acetate |
| SMILES | COc1ccc(/[13CH]=[13CH]/[13C](=O)c2c(OC)cc(OC)cc2OC(C)=O)cc1 |
| InChI | InChI=1S/C20H20O6/c1-13(21)26-19-12-16(24-3)11-18(25-4)20(19)17(22)10-7-14-5-8-15(23-2)9-6-14/h5-12H,1-4H3/b10-7+/i7+1,10+1,17+1 |
| InChIKey | GPWYAMAFBGDVII-KCCWMRILSA-N |
| XLogP | 3.53 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|