C21H24BrNO6 — CID 70455143
[3,5-dimethoxy-2-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]phenyl] (2S)-2-aminopropanoate;hydrobromide (PubChem CID 70455143) has the molecular formula C21H24BrNO6 and a molecular weight of 466.33 g/mol. Its IUPAC name is [3,5-dimethoxy-2-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]phenyl] (2S)-2-aminopropanoate;hydrobromide.
| Compound Name | [3,5-dimethoxy-2-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]phenyl] (2S)-2-aminopropanoate;hydrobromide |
|---|---|
| PubChem CID | 70455143 |
| Molecular Formula | C21H24BrNO6 |
| Molecular Weight | 466.33 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | [3,5-dimethoxy-2-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]phenyl] (2S)-2-aminopropanoate;hydrobromide |
| SMILES | Br.COc1ccc(/C=C/C(=O)c2c(OC)cc(OC)cc2OC(=O)[C@H](C)N)cc1 |
| InChI | InChI=1S/C21H23NO6.BrH/c1-13(22)21(24)28-19-12-16(26-3)11-18(27-4)20(19)17(23)10-7-14-5-8-15(25-2)9-6-14;/h5-13H,22H2,1-4H3;1H/b10-7+;/t13-;/m0./s1 |
| InChIKey | UZROURFCRCZZOZ-LIGCKOFKSA-N |
| XLogP | 3.44 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.33 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|