About 1-[2-hydroxy-4,6-dimethoxy-3-[3-(4-methylphenyl)propyl]phenyl]ethanone
1-[2-hydroxy-4,6-dimethoxy-3-[3-(4-methylphenyl)propyl]phenyl]ethanone (PubChem CID 174724954) has the molecular formula C20H24O4
and a molecular weight of 328.41 g/mol. Its IUPAC name is 1-[2-hydroxy-4,6-dimethoxy-3-[3-(4-methylphenyl)propyl]phenyl]ethanone.
Molecular Properties
| Compound Name | 1-[2-hydroxy-4,6-dimethoxy-3-[3-(4-methylphenyl)propyl]phenyl]ethanone |
| PubChem CID | 174724954 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 1-[2-hydroxy-4,6-dimethoxy-3-[3-(4-methylphenyl)propyl]phenyl]ethanone |
| SMILES | COc1cc(OC)c(C(C)=O)c(O)c1CCCc1ccc(C)cc1 |
| InChI | InChI=1S/C20H24O4/c1-13-8-10-15(11-9-13)6-5-7-16-17(23-3)12-18(24-4)19(14(2)21)20(16)22/h8-12,22H,5-7H2,1-4H3 |
| InChIKey | WKZILEXIMYYXSO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-hydroxy-4,6-dimethoxy-3-[3-(4-methylphenyl)propyl]phenyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-hydroxy-4,6-dimethoxy-3-[3-(4-methylphenyl)propyl]phenyl]ethanone?
The IUPAC name of 1-[2-hydroxy-4,6-dimethoxy-3-[3-(4-methylphenyl)propyl]phenyl]ethanone (CID 174724954) is 1-[2-hydroxy-4,6-dimethoxy-3-[3-(4-methylphenyl)propyl]phenyl]ethanone.
What is the SMILES notation for 1-[2-hydroxy-4,6-dimethoxy-3-[3-(4-methylphenyl)propyl]phenyl]ethanone?
The canonical SMILES for 1-[2-hydroxy-4,6-dimethoxy-3-[3-(4-methylphenyl)propyl]phenyl]ethanone is COc1cc(OC)c(C(C)=O)c(O)c1CCCc1ccc(C)cc1.
What is the InChIKey of 1-[2-hydroxy-4,6-dimethoxy-3-[3-(4-methylphenyl)propyl]phenyl]ethanone?
The InChIKey is WKZILEXIMYYXSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24O4/c1-13-8-10-15(11-9-13)6-5-7-16-17(23-3)12-18(24-4)19(14(2)21)20(16)22/h8-12,22H,5-7H2,1-4H3.
What are the key properties of 1-[2-hydroxy-4,6-dimethoxy-3-[3-(4-methylphenyl)propyl]phenyl]ethanone?
1-[2-hydroxy-4,6-dimethoxy-3-[3-(4-methylphenyl)propyl]phenyl]ethanone has a molecular weight of 328.41 g/mol, XLogP of 4.10, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-hydroxy-4,6-dimethoxy-3-[3-(4-methylphenyl)propyl]phenyl]ethanone is sourced from PubChem (CID 174724954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).