C26H31O7P — CID 21401919
(3,5-dimethylphenyl) [4-[3-(2,4,6-trimethoxyphenyl)propyl]phenyl] hydrogen phosphate (PubChem CID 21401919) has the molecular formula C26H31O7P and a molecular weight of 486.50 g/mol. Its IUPAC name is (3,5-dimethylphenyl) [4-[3-(2,4,6-trimethoxyphenyl)propyl]phenyl] hydrogen phosphate.
| Compound Name | (3,5-dimethylphenyl) [4-[3-(2,4,6-trimethoxyphenyl)propyl]phenyl] hydrogen phosphate |
|---|---|
| PubChem CID | 21401919 |
| Molecular Formula | C26H31O7P |
| Molecular Weight | 486.50 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | (3,5-dimethylphenyl) [4-[3-(2,4,6-trimethoxyphenyl)propyl]phenyl] hydrogen phosphate |
| SMILES | COc1cc(OC)c(CCCc2ccc(OP(=O)(O)Oc3cc(C)cc(C)c3)cc2)c(OC)c1 |
| InChI | InChI=1S/C26H31O7P/c1-18-13-19(2)15-23(14-18)33-34(27,28)32-21-11-9-20(10-12-21)7-6-8-24-25(30-4)16-22(29-3)17-26(24)31-5/h9-17H,6-8H2,1-5H3,(H,27,28) |
| InChIKey | BZZOOFWGXQHXNW-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.50 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|