C20H24I3O3- — CID 163757511
2-iodo-3-[(Z)-4-iodoiodanuidyl-3-methylbut-2-enyl]-4-methoxy-6-[(Z)-3-methylidenehex-4-enyl]benzoic acid (PubChem CID 163757511) has the molecular formula C20H24I3O3- and a molecular weight of 693.12 g/mol. Its IUPAC name is 2-iodo-3-[(Z)-4-iodoiodanuidyl-3-methylbut-2-enyl]-4-methoxy-6-[(Z)-3-methylidenehex-4-enyl]benzoic acid.
| Compound Name | 2-iodo-3-[(Z)-4-iodoiodanuidyl-3-methylbut-2-enyl]-4-methoxy-6-[(Z)-3-methylidenehex-4-enyl]benzoic acid |
|---|---|
| PubChem CID | 163757511 |
| Molecular Formula | C20H24I3O3- |
| Molecular Weight | 693.12 g/mol |
| Exact Mass | 692.89 |
| IUPAC Name | 2-iodo-3-[(Z)-4-iodoiodanuidyl-3-methylbut-2-enyl]-4-methoxy-6-[(Z)-3-methylidenehex-4-enyl]benzoic acid |
| SMILES | C=C(/C=C\C)CCc1cc(OC)c(C/C=C(/C)C[I-]I)c(I)c1C(=O)O |
| InChI | InChI=1S/C20H24I3O3/c1-5-6-13(2)7-9-15-11-17(26-4)16(10-8-14(3)12-23-22)19(21)18(15)20(24)25/h5-6,8,11H,2,7,9-10,12H2,1,3-4H3,(H,24,25)/q-1/b6-5-,14-8- |
| InChIKey | WOGIQHFGCPTMKM-DICXBPMKSA-N |
| XLogP | 2.99 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.12 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|