C24H27FO2 — CID 75038821
2-(3,7-dimethylocta-2,6-dienyl)-5-[2-(4-fluorophenyl)ethenyl]benzene-1,3-diol (PubChem CID 75038821) has the molecular formula C24H27FO2 and a molecular weight of 366.48 g/mol. Its IUPAC name is 2-(3,7-dimethylocta-2,6-dienyl)-5-[2-(4-fluorophenyl)ethenyl]benzene-1,3-diol.
| Compound Name | 2-(3,7-dimethylocta-2,6-dienyl)-5-[2-(4-fluorophenyl)ethenyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 75038821 |
| Molecular Formula | C24H27FO2 |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | 2-(3,7-dimethylocta-2,6-dienyl)-5-[2-(4-fluorophenyl)ethenyl]benzene-1,3-diol |
| SMILES | CC(C)=CCCC(C)=CCc1c(O)cc(C=Cc2ccc(F)cc2)cc1O |
| InChI | InChI=1S/C24H27FO2/c1-17(2)5-4-6-18(3)7-14-22-23(26)15-20(16-24(22)27)9-8-19-10-12-21(25)13-11-19/h5,7-13,15-16,26-27H,4,6,14H2,1-3H3 |
| InChIKey | HNZQKUZQEQIPDM-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|