C44H64O4 — CID 172870007
2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-[2-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenoxy]ethoxy]-5-pentylphenol (PubChem CID 172870007) has the molecular formula C44H64O4 and a molecular weight of 656.99 g/mol. Its IUPAC name is 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-[2-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenoxy]ethoxy]-5-pentylphenol.
| Compound Name | 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-[2-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenoxy]ethoxy]-5-pentylphenol |
|---|---|
| PubChem CID | 172870007 |
| Molecular Formula | C44H64O4 |
| Molecular Weight | 656.99 g/mol |
| Exact Mass | 656.48 |
| IUPAC Name | 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-[2-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenoxy]ethoxy]-5-pentylphenol |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(O)cc(CCCCC)cc1OCCOc1cc(CCCCC)cc(O)c1C/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C44H64O4/c1-9-11-13-18-35-27-40(45)38(23-20-33(7)17-15-16-31(3)4)42(29-35)47-24-25-48-43-30-36(19-14-12-10-2)28-41(46)44(43)39-26-34(8)21-22-37(39)32(5)6/h16,20,26-30,37,39,45-46H,5,9-15,17-19,21-25H2,1-4,6-8H3/b33-20+/t37-,39+/m0/s1 |
| InChIKey | JEVWNYILHCPFOV-KTRMVMIJSA-N |
| XLogP | 12.27 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.99 |
| LogP ≤ 5 | 12.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|