C32H46O4 — CID 154171045
5-(3,7-dimethylocta-2,6-dienyl)-2,4-dihydroxy-3-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-6-pentylbenzoic acid (PubChem CID 154171045) has the molecular formula C32H46O4 and a molecular weight of 494.72 g/mol. Its IUPAC name is 5-(3,7-dimethylocta-2,6-dienyl)-2,4-dihydroxy-3-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-6-pentylbenzoic acid.
| Compound Name | 5-(3,7-dimethylocta-2,6-dienyl)-2,4-dihydroxy-3-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-6-pentylbenzoic acid |
|---|---|
| PubChem CID | 154171045 |
| Molecular Formula | C32H46O4 |
| Molecular Weight | 494.72 g/mol |
| Exact Mass | 494.34 |
| IUPAC Name | 5-(3,7-dimethylocta-2,6-dienyl)-2,4-dihydroxy-3-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-6-pentylbenzoic acid |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(O)c(CC=C(C)CCC=C(C)C)c(CCCCC)c(C(=O)O)c1O |
| InChI | InChI=1S/C32H46O4/c1-8-9-10-14-25-26(18-15-22(6)13-11-12-20(2)3)30(33)28(31(34)29(25)32(35)36)27-19-23(7)16-17-24(27)21(4)5/h12,15,19,24,27,33-34H,4,8-11,13-14,16-18H2,1-3,5-7H3,(H,35,36)/t24-,27+/m0/s1 |
| InChIKey | KWXJITZWOBUTEE-RPLLCQBOSA-N |
| XLogP | 8.78 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.72 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|