C31H46O2 — CID 155405630
4-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylbenzene-1,3-diol (PubChem CID 155405630) has the molecular formula C31H46O2 and a molecular weight of 450.71 g/mol. Its IUPAC name is 4-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylbenzene-1,3-diol.
| Compound Name | 4-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylbenzene-1,3-diol |
|---|---|
| PubChem CID | 155405630 |
| Molecular Formula | C31H46O2 |
| Molecular Weight | 450.71 g/mol |
| Exact Mass | 450.35 |
| IUPAC Name | 4-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylbenzene-1,3-diol |
| SMILES | C=C(C)C1CCC(C)=CC1c1c(O)cc(CCCCC)c(C/C=C(\C)CCC=C(C)C)c1O |
| InChI | InChI=1S/C31H46O2/c1-8-9-10-14-25-20-29(32)30(28-19-24(7)16-17-26(28)22(4)5)31(33)27(25)18-15-23(6)13-11-12-21(2)3/h12,15,19-20,26,28,32-33H,4,8-11,13-14,16-18H2,1-3,5-7H3/b23-15+ |
| InChIKey | XWEKRYPYPBVXDU-HZHRSRAPSA-N |
| XLogP | 9.08 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.71 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|