C32H44O5 — CID 123400048
3,7-dimethylocta-2,6-dienyl 2,4,5-trihydroxy-3-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-6-[(E)-pent-1-enyl]benzoate (PubChem CID 123400048) has the molecular formula C32H44O5 and a molecular weight of 508.70 g/mol. Its IUPAC name is 3,7-dimethylocta-2,6-dienyl 2,4,5-trihydroxy-3-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-6-[(E)-pent-1-enyl]benzoate.
| Compound Name | 3,7-dimethylocta-2,6-dienyl 2,4,5-trihydroxy-3-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-6-[(E)-pent-1-enyl]benzoate |
|---|---|
| PubChem CID | 123400048 |
| Molecular Formula | C32H44O5 |
| Molecular Weight | 508.70 g/mol |
| Exact Mass | 508.32 |
| IUPAC Name | 3,7-dimethylocta-2,6-dienyl 2,4,5-trihydroxy-3-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-6-[(E)-pent-1-enyl]benzoate |
| SMILES | C=C(C)C1CCC(C)=CC1c1c(O)c(O)c(/C=C/CCC)c(C(=O)OCC=C(C)CCC=C(C)C)c1O |
| InChI | InChI=1S/C32H44O5/c1-8-9-10-14-25-28(32(36)37-18-17-22(6)13-11-12-20(2)3)30(34)27(31(35)29(25)33)26-19-23(7)15-16-24(26)21(4)5/h10,12,14,17,19,24,26,33-35H,4,8-9,11,13,15-16,18H2,1-3,5-7H3/b14-10+,22-17? |
| InChIKey | OIRJMDTWTTXOCK-NONNEFQTSA-N |
| XLogP | 8.48 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.70 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|