C25H30O5 — CID 14186718
7-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,6,8,9-tetrahydroxy-3-methyl-2,4-dihydroanthracen-1-one (PubChem CID 14186718) has the molecular formula C25H30O5 and a molecular weight of 410.51 g/mol. Its IUPAC name is 7-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,6,8,9-tetrahydroxy-3-methyl-2,4-dihydroanthracen-1-one.
| Compound Name | 7-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,6,8,9-tetrahydroxy-3-methyl-2,4-dihydroanthracen-1-one |
|---|---|
| PubChem CID | 14186718 |
| Molecular Formula | C25H30O5 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 7-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,6,8,9-tetrahydroxy-3-methyl-2,4-dihydroanthracen-1-one |
| SMILES | CC(C)=CCC/C(C)=C/Cc1c(O)cc2cc3c(c(O)c2c1O)C(=O)CC(C)(O)C3 |
| InChI | InChI=1S/C25H30O5/c1-14(2)6-5-7-15(3)8-9-18-19(26)11-16-10-17-12-25(4,30)13-20(27)21(17)24(29)22(16)23(18)28/h6,8,10-11,26,28-30H,5,7,9,12-13H2,1-4H3/b15-8+ |
| InChIKey | GUJKRVVBNWGDJR-OVCLIPMQSA-N |
| XLogP | 5.07 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|