C23H29NO2 — CID 68508915
4-(3,7,11-trimethyldodeca-2,6,10-trienyl)isoindole-1,3-dione (PubChem CID 68508915) has the molecular formula C23H29NO2 and a molecular weight of 351.49 g/mol. Its IUPAC name is 4-(3,7,11-trimethyldodeca-2,6,10-trienyl)isoindole-1,3-dione.
| Compound Name | 4-(3,7,11-trimethyldodeca-2,6,10-trienyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 68508915 |
| Molecular Formula | C23H29NO2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | 4-(3,7,11-trimethyldodeca-2,6,10-trienyl)isoindole-1,3-dione |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCc1cccc2c1C(=O)NC2=O |
| InChI | InChI=1S/C23H29NO2/c1-16(2)8-5-9-17(3)10-6-11-18(4)14-15-19-12-7-13-20-21(19)23(26)24-22(20)25/h7-8,10,12-14H,5-6,9,11,15H2,1-4H3,(H,24,25,26) |
| InChIKey | JZNFQIPFYLAOAI-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|