C26H37NO6 — CID 139627323
(2E,6E,10E)-12-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-N-(1-hydroxyethyl)-2,6,10-trimethyldodeca-2,6,10-trienamide (PubChem CID 139627323) has the molecular formula C26H37NO6 and a molecular weight of 459.58 g/mol. Its IUPAC name is (2E,6E,10E)-12-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-N-(1-hydroxyethyl)-2,6,10-trimethyldodeca-2,6,10-trienamide.
| Compound Name | (2E,6E,10E)-12-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-N-(1-hydroxyethyl)-2,6,10-trimethyldodeca-2,6,10-trienamide |
|---|---|
| PubChem CID | 139627323 |
| Molecular Formula | C26H37NO6 |
| Molecular Weight | 459.58 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | (2E,6E,10E)-12-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-N-(1-hydroxyethyl)-2,6,10-trimethyldodeca-2,6,10-trienamide |
| SMILES | COC1=C(OC)C(=O)C(C/C=C(\C)CC/C=C(\C)CC/C=C(\C)C(=O)NC(C)O)=C(C)C1=O |
| InChI | InChI=1S/C26H37NO6/c1-16(12-9-13-18(3)26(31)27-20(5)28)10-8-11-17(2)14-15-21-19(4)22(29)24(32-6)25(33-7)23(21)30/h10,13-14,20,28H,8-9,11-12,15H2,1-7H3,(H,27,31)/b16-10+,17-14+,18-13+ |
| InChIKey | QVRCSHPPFGNUID-XZIOZQPPSA-N |
| XLogP | 4.20 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.58 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|