C40H54O6 — CID 176845249
3-[(2Z)-3,6-dimethylhepta-2,5-dienyl]-5-[5-[(2Z)-3,6-dimethylhepta-2,5-dienyl]-6-hydroxy-3,4-dioxo-2-pentylcyclohexa-1,5-dien-1-yl]-4-hydroxy-6-pentylcyclohexa-3,5-diene-1,2-dione (PubChem CID 176845249) has the molecular formula C40H54O6 and a molecular weight of 630.87 g/mol. Its IUPAC name is 3-[(2Z)-3,6-dimethylhepta-2,5-dienyl]-5-[5-[(2Z)-3,6-dimethylhepta-2,5-dienyl]-6-hydroxy-3,4-dioxo-2-pentylcyclohexa-1,5-dien-1-yl]-4-hydroxy-6-pentylcyclohexa-3,5-diene-1,2-dione.
| Compound Name | 3-[(2Z)-3,6-dimethylhepta-2,5-dienyl]-5-[5-[(2Z)-3,6-dimethylhepta-2,5-dienyl]-6-hydroxy-3,4-dioxo-2-pentylcyclohexa-1,5-dien-1-yl]-4-hydroxy-6-pentylcyclohexa-3,5-diene-1,2-dione |
|---|---|
| PubChem CID | 176845249 |
| Molecular Formula | C40H54O6 |
| Molecular Weight | 630.87 g/mol |
| Exact Mass | 630.39 |
| IUPAC Name | 3-[(2Z)-3,6-dimethylhepta-2,5-dienyl]-5-[5-[(2Z)-3,6-dimethylhepta-2,5-dienyl]-6-hydroxy-3,4-dioxo-2-pentylcyclohexa-1,5-dien-1-yl]-4-hydroxy-6-pentylcyclohexa-3,5-diene-1,2-dione |
| SMILES | CCCCCC1=C(C2=C(CCCCC)C(=O)C(=O)C(C/C=C(/C)CC=C(C)C)=C2O)C(O)=C(C/C=C(/C)CC=C(C)C)C(=O)C1=O |
| InChI | InChI=1S/C40H54O6/c1-9-11-13-15-29-33(35(41)31(39(45)37(29)43)23-21-27(7)19-17-25(3)4)34-30(16-14-12-10-2)38(44)40(46)32(36(34)42)24-22-28(8)20-18-26(5)6/h17-18,21-22,41-42H,9-16,19-20,23-24H2,1-8H3/b27-21-,28-22- |
| InChIKey | MQBVTCXTTLWCLW-ZDSKVHJSSA-N |
| XLogP | 10.05 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.87 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|