C24H38O2 — CID 177190635
2-[(2Z)-3,6-dimethylhepta-2,5-dienyl]-5-(2-methyloctan-2-yl)benzene-1,3-diol (PubChem CID 177190635) has the molecular formula C24H38O2 and a molecular weight of 358.57 g/mol. Its IUPAC name is 2-[(2Z)-3,6-dimethylhepta-2,5-dienyl]-5-(2-methyloctan-2-yl)benzene-1,3-diol.
| Compound Name | 2-[(2Z)-3,6-dimethylhepta-2,5-dienyl]-5-(2-methyloctan-2-yl)benzene-1,3-diol |
|---|---|
| PubChem CID | 177190635 |
| Molecular Formula | C24H38O2 |
| Molecular Weight | 358.57 g/mol |
| Exact Mass | 358.29 |
| IUPAC Name | 2-[(2Z)-3,6-dimethylhepta-2,5-dienyl]-5-(2-methyloctan-2-yl)benzene-1,3-diol |
| SMILES | CCCCCCC(C)(C)c1cc(O)c(C/C=C(/C)CC=C(C)C)c(O)c1 |
| InChI | InChI=1S/C24H38O2/c1-7-8-9-10-15-24(5,6)20-16-22(25)21(23(26)17-20)14-13-19(4)12-11-18(2)3/h11,13,16-17,25-26H,7-10,12,14-15H2,1-6H3/b19-13- |
| InChIKey | GGVYYWUMORSXGO-UYRXBGFRSA-N |
| XLogP | 7.19 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.57 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|