C21H30O — CID 143249985
2-[(3E)-hexa-1,3,5-trien-3-yl]-5-(2-methyloctan-2-yl)phenol (PubChem CID 143249985) has the molecular formula C21H30O and a molecular weight of 298.47 g/mol. Its IUPAC name is 2-[(3E)-hexa-1,3,5-trien-3-yl]-5-(2-methyloctan-2-yl)phenol.
| Compound Name | 2-[(3E)-hexa-1,3,5-trien-3-yl]-5-(2-methyloctan-2-yl)phenol |
|---|---|
| PubChem CID | 143249985 |
| Molecular Formula | C21H30O |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | 2-[(3E)-hexa-1,3,5-trien-3-yl]-5-(2-methyloctan-2-yl)phenol |
| SMILES | C=C/C=C(\C=C)c1ccc(C(C)(C)CCCCCC)cc1O |
| InChI | InChI=1S/C21H30O/c1-6-9-10-11-15-21(4,5)18-13-14-19(20(22)16-18)17(8-3)12-7-2/h7-8,12-14,16,22H,2-3,6,9-11,15H2,1,4-5H3/b17-12+ |
| InChIKey | ZDGYABFDZGTVCG-SFQUDFHCSA-N |
| XLogP | 6.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|