C24H36O4 — CID 142867085
2-[2,5-bis(hydroxymethyl)phenyl]-5-(2-methyloctan-2-yl)phenol;methanol (PubChem CID 142867085) has the molecular formula C24H36O4 and a molecular weight of 388.55 g/mol. Its IUPAC name is 2-[2,5-bis(hydroxymethyl)phenyl]-5-(2-methyloctan-2-yl)phenol;methanol.
| Compound Name | 2-[2,5-bis(hydroxymethyl)phenyl]-5-(2-methyloctan-2-yl)phenol;methanol |
|---|---|
| PubChem CID | 142867085 |
| Molecular Formula | C24H36O4 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | 2-[2,5-bis(hydroxymethyl)phenyl]-5-(2-methyloctan-2-yl)phenol;methanol |
| SMILES | CCCCCCC(C)(C)c1ccc(-c2cc(CO)ccc2CO)c(O)c1.CO |
| InChI | InChI=1S/C23H32O3.CH4O/c1-4-5-6-7-12-23(2,3)19-10-11-20(22(26)14-19)21-13-17(15-24)8-9-18(21)16-25;1-2/h8-11,13-14,24-26H,4-7,12,15-16H2,1-3H3;2H,1H3 |
| InChIKey | YBVMMGDTKLPZCC-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|