C25H36N2O2 — CID 11596397
1-ethyl-3-[[2-[2-hydroxy-4-(2-methyloctan-2-yl)phenyl]phenyl]methyl]urea (PubChem CID 11596397) has the molecular formula C25H36N2O2 and a molecular weight of 396.58 g/mol. Its IUPAC name is 1-ethyl-3-[[2-[2-hydroxy-4-(2-methyloctan-2-yl)phenyl]phenyl]methyl]urea.
| Compound Name | 1-ethyl-3-[[2-[2-hydroxy-4-(2-methyloctan-2-yl)phenyl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 11596397 |
| Molecular Formula | C25H36N2O2 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.28 |
| IUPAC Name | 1-ethyl-3-[[2-[2-hydroxy-4-(2-methyloctan-2-yl)phenyl]phenyl]methyl]urea |
| SMILES | CCCCCCC(C)(C)c1ccc(-c2ccccc2CNC(=O)NCC)c(O)c1 |
| InChI | InChI=1S/C25H36N2O2/c1-5-7-8-11-16-25(3,4)20-14-15-22(23(28)17-20)21-13-10-9-12-19(21)18-27-24(29)26-6-2/h9-10,12-15,17,28H,5-8,11,16,18H2,1-4H3,(H2,26,27,29) |
| InChIKey | IITIBFWSYVGQBN-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|