C30H39N3O5 — CID 11713364
N-[[2-[2-hydroxy-4-(2-methyl-7-morpholin-4-yl-7-oxoheptan-2-yl)phenyl]phenyl]methyl]-5-oxopyrrolidine-2-carboxamide (PubChem CID 11713364) has the molecular formula C30H39N3O5 and a molecular weight of 521.66 g/mol. Its IUPAC name is N-[[2-[2-hydroxy-4-(2-methyl-7-morpholin-4-yl-7-oxoheptan-2-yl)phenyl]phenyl]methyl]-5-oxopyrrolidine-2-carboxamide.
| Compound Name | N-[[2-[2-hydroxy-4-(2-methyl-7-morpholin-4-yl-7-oxoheptan-2-yl)phenyl]phenyl]methyl]-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 11713364 |
| Molecular Formula | C30H39N3O5 |
| Molecular Weight | 521.66 g/mol |
| Exact Mass | 521.29 |
| IUPAC Name | N-[[2-[2-hydroxy-4-(2-methyl-7-morpholin-4-yl-7-oxoheptan-2-yl)phenyl]phenyl]methyl]-5-oxopyrrolidine-2-carboxamide |
| SMILES | CC(C)(CCCCC(=O)N1CCOCC1)c1ccc(-c2ccccc2CNC(=O)C2CCC(=O)N2)c(O)c1 |
| InChI | InChI=1S/C30H39N3O5/c1-30(2,14-6-5-9-28(36)33-15-17-38-18-16-33)22-10-11-24(26(34)19-22)23-8-4-3-7-21(23)20-31-29(37)25-12-13-27(35)32-25/h3-4,7-8,10-11,19,25,34H,5-6,9,12-18,20H2,1-2H3,(H,31,37)(H,32,35) |
| InChIKey | ZBEMSTVDGYIFKI-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.66 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|