C36H48N2O4 — CID 56636749
5-methyl-5-[7-(2-methyl-6-morpholin-4-yl-6-oxohexan-2-yl)anthracen-2-yl]-1-morpholin-4-ylhexan-1-one (PubChem CID 56636749) has the molecular formula C36H48N2O4 and a molecular weight of 572.79 g/mol. Its IUPAC name is 5-methyl-5-[7-(2-methyl-6-morpholin-4-yl-6-oxohexan-2-yl)anthracen-2-yl]-1-morpholin-4-ylhexan-1-one.
| Compound Name | 5-methyl-5-[7-(2-methyl-6-morpholin-4-yl-6-oxohexan-2-yl)anthracen-2-yl]-1-morpholin-4-ylhexan-1-one |
|---|---|
| PubChem CID | 56636749 |
| Molecular Formula | C36H48N2O4 |
| Molecular Weight | 572.79 g/mol |
| Exact Mass | 572.36 |
| IUPAC Name | 5-methyl-5-[7-(2-methyl-6-morpholin-4-yl-6-oxohexan-2-yl)anthracen-2-yl]-1-morpholin-4-ylhexan-1-one |
| SMILES | CC(C)(CCCC(=O)N1CCOCC1)c1ccc2cc3ccc(C(C)(C)CCCC(=O)N4CCOCC4)cc3cc2c1 |
| InChI | InChI=1S/C36H48N2O4/c1-35(2,13-5-7-33(39)37-15-19-41-20-16-37)31-11-9-27-23-28-10-12-32(26-30(28)24-29(27)25-31)36(3,4)14-6-8-34(40)38-17-21-42-22-18-38/h9-12,23-26H,5-8,13-22H2,1-4H3 |
| InChIKey | RCBJGLNCAOGIEM-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.79 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|