C29H41N3O4 — CID 11555038
1-[[2-[2-hydroxy-4-(2-methyl-7-morpholin-4-yl-7-oxoheptan-2-yl)phenyl]phenyl]methyl]-3-propan-2-ylurea (PubChem CID 11555038) has the molecular formula C29H41N3O4 and a molecular weight of 495.66 g/mol. Its IUPAC name is 1-[[2-[2-hydroxy-4-(2-methyl-7-morpholin-4-yl-7-oxoheptan-2-yl)phenyl]phenyl]methyl]-3-propan-2-ylurea.
| Compound Name | 1-[[2-[2-hydroxy-4-(2-methyl-7-morpholin-4-yl-7-oxoheptan-2-yl)phenyl]phenyl]methyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 11555038 |
| Molecular Formula | C29H41N3O4 |
| Molecular Weight | 495.66 g/mol |
| Exact Mass | 495.31 |
| IUPAC Name | 1-[[2-[2-hydroxy-4-(2-methyl-7-morpholin-4-yl-7-oxoheptan-2-yl)phenyl]phenyl]methyl]-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)NCc1ccccc1-c1ccc(C(C)(C)CCCCC(=O)N2CCOCC2)cc1O |
| InChI | InChI=1S/C29H41N3O4/c1-21(2)31-28(35)30-20-22-9-5-6-10-24(22)25-13-12-23(19-26(25)33)29(3,4)14-8-7-11-27(34)32-15-17-36-18-16-32/h5-6,9-10,12-13,19,21,33H,7-8,11,14-18,20H2,1-4H3,(H2,30,31,35) |
| InChIKey | WXBLLNIQMCHXLT-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.66 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|