C20H29N3O4 — CID 51122736
1-[(2-cyclopentyloxyphenyl)methyl]-3-(3-morpholin-4-yl-3-oxopropyl)urea (PubChem CID 51122736) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is 1-[(2-cyclopentyloxyphenyl)methyl]-3-(3-morpholin-4-yl-3-oxopropyl)urea.
| Compound Name | 1-[(2-cyclopentyloxyphenyl)methyl]-3-(3-morpholin-4-yl-3-oxopropyl)urea |
|---|---|
| PubChem CID | 51122736 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | 1-[(2-cyclopentyloxyphenyl)methyl]-3-(3-morpholin-4-yl-3-oxopropyl)urea |
| SMILES | O=C(NCCC(=O)N1CCOCC1)NCc1ccccc1OC1CCCC1 |
| InChI | InChI=1S/C20H29N3O4/c24-19(23-11-13-26-14-12-23)9-10-21-20(25)22-15-16-5-1-4-8-18(16)27-17-6-2-3-7-17/h1,4-5,8,17H,2-3,6-7,9-15H2,(H2,21,22,25) |
| InChIKey | UGIXXHGUMLTCKK-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |