C18H25N3O3 — CID 56797916
1-N-[(2-cyclopentyloxyphenyl)methyl]pyrrolidine-1,3-dicarboxamide (PubChem CID 56797916) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is 1-N-[(2-cyclopentyloxyphenyl)methyl]pyrrolidine-1,3-dicarboxamide.
| Compound Name | 1-N-[(2-cyclopentyloxyphenyl)methyl]pyrrolidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 56797916 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 1-N-[(2-cyclopentyloxyphenyl)methyl]pyrrolidine-1,3-dicarboxamide |
| SMILES | NC(=O)C1CCN(C(=O)NCc2ccccc2OC2CCCC2)C1 |
| InChI | InChI=1S/C18H25N3O3/c19-17(22)14-9-10-21(12-14)18(23)20-11-13-5-1-4-8-16(13)24-15-6-2-3-7-15/h1,4-5,8,14-15H,2-3,6-7,9-12H2,(H2,19,22)(H,20,23) |
| InChIKey | LGLYXCNWLYXGMU-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |