C20H27N3O2 — CID 98203831
(3R)-N-[(2-cyclobutyloxyphenyl)methyl]-3-(2,5-dihydropyrrol-1-yl)pyrrolidine-1-carboxamide (PubChem CID 98203831) has the molecular formula C20H27N3O2 and a molecular weight of 341.46 g/mol. Its IUPAC name is (3R)-N-[(2-cyclobutyloxyphenyl)methyl]-3-(2,5-dihydropyrrol-1-yl)pyrrolidine-1-carboxamide.
| Compound Name | (3R)-N-[(2-cyclobutyloxyphenyl)methyl]-3-(2,5-dihydropyrrol-1-yl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 98203831 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | (3R)-N-[(2-cyclobutyloxyphenyl)methyl]-3-(2,5-dihydropyrrol-1-yl)pyrrolidine-1-carboxamide |
| SMILES | O=C(NCc1ccccc1OC1CCC1)N1CC[C@@H](N2CC=CC2)C1 |
| InChI | InChI=1S/C20H27N3O2/c24-20(23-13-10-17(15-23)22-11-3-4-12-22)21-14-16-6-1-2-9-19(16)25-18-7-5-8-18/h1-4,6,9,17-18H,5,7-8,10-15H2,(H,21,24)/t17-/m1/s1 |
| InChIKey | CFXUGURSDPLMSQ-QGZVFWFLSA-N |
| XLogP | 2.77 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|