C20H29N3O2 — CID 97317387
1-[(7R,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl]-3-[(2-cyclobutyloxyphenyl)methyl]urea (PubChem CID 97317387) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is 1-[(7R,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl]-3-[(2-cyclobutyloxyphenyl)methyl]urea.
| Compound Name | 1-[(7R,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl]-3-[(2-cyclobutyloxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 97317387 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | 1-[(7R,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl]-3-[(2-cyclobutyloxyphenyl)methyl]urea |
| SMILES | O=C(NCc1ccccc1OC1CCC1)N[C@@H]1CCN2CCC[C@@H]2C1 |
| InChI | InChI=1S/C20H29N3O2/c24-20(22-16-10-12-23-11-4-6-17(23)13-16)21-14-15-5-1-2-9-19(15)25-18-7-3-8-18/h1-2,5,9,16-18H,3-4,6-8,10-14H2,(H2,21,22,24)/t16-,17-/m1/s1 |
| InChIKey | PCCMCKCIQNFSHI-IAGOWNOFSA-N |
| XLogP | 3.04 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |