C16H21F3N2O2 — CID 166180379
1-(3-methylcyclohexyl)-3-[[2-(trifluoromethoxy)phenyl]methyl]urea (PubChem CID 166180379) has the molecular formula C16H21F3N2O2 and a molecular weight of 330.35 g/mol. Its IUPAC name is 1-(3-methylcyclohexyl)-3-[[2-(trifluoromethoxy)phenyl]methyl]urea.
| Compound Name | 1-(3-methylcyclohexyl)-3-[[2-(trifluoromethoxy)phenyl]methyl]urea |
|---|---|
| PubChem CID | 166180379 |
| Molecular Formula | C16H21F3N2O2 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 1-(3-methylcyclohexyl)-3-[[2-(trifluoromethoxy)phenyl]methyl]urea |
| SMILES | CC1CCCC(NC(=O)NCc2ccccc2OC(F)(F)F)C1 |
| InChI | InChI=1S/C16H21F3N2O2/c1-11-5-4-7-13(9-11)21-15(22)20-10-12-6-2-3-8-14(12)23-16(17,18)19/h2-3,6,8,11,13H,4-5,7,9-10H2,1H3,(H2,20,21,22) |
| InChIKey | XTHDIMCPJQXVDT-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |