C15H16F3NO4 — CID 146134402
1-[[2-(trifluoromethoxy)phenyl]methylcarbamoyl]cyclopentane-1-carboxylic acid (PubChem CID 146134402) has the molecular formula C15H16F3NO4 and a molecular weight of 331.29 g/mol. Its IUPAC name is 1-[[2-(trifluoromethoxy)phenyl]methylcarbamoyl]cyclopentane-1-carboxylic acid.
| Compound Name | 1-[[2-(trifluoromethoxy)phenyl]methylcarbamoyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 146134402 |
| Molecular Formula | C15H16F3NO4 |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 1-[[2-(trifluoromethoxy)phenyl]methylcarbamoyl]cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1(C(=O)NCc2ccccc2OC(F)(F)F)CCCC1 |
| InChI | InChI=1S/C15H16F3NO4/c16-15(17,18)23-11-6-2-1-5-10(11)9-19-12(20)14(13(21)22)7-3-4-8-14/h1-2,5-6H,3-4,7-9H2,(H,19,20)(H,21,22) |
| InChIKey | YBGHAXMRTXEBAF-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|