C15H16F4N2O2 — CID 166520253
1-[[2-fluoro-3-(trifluoromethoxy)phenyl]methyl]-3-spiro[2.3]hexan-5-ylurea (PubChem CID 166520253) has the molecular formula C15H16F4N2O2 and a molecular weight of 332.30 g/mol. Its IUPAC name is 1-[[2-fluoro-3-(trifluoromethoxy)phenyl]methyl]-3-spiro[2.3]hexan-5-ylurea.
| Compound Name | 1-[[2-fluoro-3-(trifluoromethoxy)phenyl]methyl]-3-spiro[2.3]hexan-5-ylurea |
|---|---|
| PubChem CID | 166520253 |
| Molecular Formula | C15H16F4N2O2 |
| Molecular Weight | 332.30 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 1-[[2-fluoro-3-(trifluoromethoxy)phenyl]methyl]-3-spiro[2.3]hexan-5-ylurea |
| SMILES | O=C(NCc1cccc(OC(F)(F)F)c1F)NC1CC2(CC2)C1 |
| InChI | InChI=1S/C15H16F4N2O2/c16-12-9(2-1-3-11(12)23-15(17,18)19)8-20-13(22)21-10-6-14(7-10)4-5-14/h1-3,10H,4-8H2,(H2,20,21,22) |
| InChIKey | UBNIQAZOIKKDDH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.30 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |