C19H27N3O — CID 98203455
(3R)-3-(2,5-dihydropyrrol-1-yl)-N-[(3S)-3-phenylbutyl]pyrrolidine-1-carboxamide (PubChem CID 98203455) has the molecular formula C19H27N3O and a molecular weight of 313.44 g/mol. Its IUPAC name is (3R)-3-(2,5-dihydropyrrol-1-yl)-N-[(3S)-3-phenylbutyl]pyrrolidine-1-carboxamide.
| Compound Name | (3R)-3-(2,5-dihydropyrrol-1-yl)-N-[(3S)-3-phenylbutyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 98203455 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | (3R)-3-(2,5-dihydropyrrol-1-yl)-N-[(3S)-3-phenylbutyl]pyrrolidine-1-carboxamide |
| SMILES | C[C@@H](CCNC(=O)N1CC[C@@H](N2CC=CC2)C1)c1ccccc1 |
| InChI | InChI=1S/C19H27N3O/c1-16(17-7-3-2-4-8-17)9-11-20-19(23)22-14-10-18(15-22)21-12-5-6-13-21/h2-8,16,18H,9-15H2,1H3,(H,20,23)/t16-,18+/m0/s1 |
| InChIKey | XJGUOILTVZHYGI-FUHWJXTLSA-N |
| XLogP | 2.84 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|