C22H29N3O — CID 86876623
4-phenyl-N-(3-phenylbutyl)-1,4-diazepane-1-carboxamide (PubChem CID 86876623) has the molecular formula C22H29N3O and a molecular weight of 351.49 g/mol. Its IUPAC name is 4-phenyl-N-(3-phenylbutyl)-1,4-diazepane-1-carboxamide.
| Compound Name | 4-phenyl-N-(3-phenylbutyl)-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 86876623 |
| Molecular Formula | C22H29N3O |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | 4-phenyl-N-(3-phenylbutyl)-1,4-diazepane-1-carboxamide |
| SMILES | CC(CCNC(=O)N1CCCN(c2ccccc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C22H29N3O/c1-19(20-9-4-2-5-10-20)13-14-23-22(26)25-16-8-15-24(17-18-25)21-11-6-3-7-12-21/h2-7,9-12,19H,8,13-18H2,1H3,(H,23,26) |
| InChIKey | GELCZKDNFFMORN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |