C18H26N2O3 — CID 94816549
N-[(3R)-3-phenylbutyl]-1,4-dioxa-8-azaspiro[4.5]decane-8-carboxamide (PubChem CID 94816549) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is N-[(3R)-3-phenylbutyl]-1,4-dioxa-8-azaspiro[4.5]decane-8-carboxamide.
| Compound Name | N-[(3R)-3-phenylbutyl]-1,4-dioxa-8-azaspiro[4.5]decane-8-carboxamide |
|---|---|
| PubChem CID | 94816549 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | N-[(3R)-3-phenylbutyl]-1,4-dioxa-8-azaspiro[4.5]decane-8-carboxamide |
| SMILES | C[C@H](CCNC(=O)N1CCC2(CC1)OCCO2)c1ccccc1 |
| InChI | InChI=1S/C18H26N2O3/c1-15(16-5-3-2-4-6-16)7-10-19-17(21)20-11-8-18(9-12-20)22-13-14-23-18/h2-6,15H,7-14H2,1H3,(H,19,21)/t15-/m1/s1 |
| InChIKey | IGCTWBHFDUJQTK-OAHLLOKOSA-N |
| XLogP | 2.73 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |