C15H20N2O3 — CID 3729330
N-benzyl-1,4-dioxa-8-azaspiro[4.5]decane-8-carboxamide (PubChem CID 3729330) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is N-benzyl-1,4-dioxa-8-azaspiro[4.5]decane-8-carboxamide.
| Compound Name | N-benzyl-1,4-dioxa-8-azaspiro[4.5]decane-8-carboxamide |
|---|---|
| PubChem CID | 3729330 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | N-benzyl-1,4-dioxa-8-azaspiro[4.5]decane-8-carboxamide |
| SMILES | O=C(NCc1ccccc1)N1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C15H20N2O3/c18-14(16-12-13-4-2-1-3-5-13)17-8-6-15(7-9-17)19-10-11-20-15/h1-5H,6-12H2,(H,16,18) |
| InChIKey | PWPYIKWULOCDGQ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |