C20H28N2O4 — CID 122122322
1-[(2-cyclopentyloxyphenyl)methylcarbamoyl]-5-methylpiperidine-3-carboxylic acid (PubChem CID 122122322) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is 1-[(2-cyclopentyloxyphenyl)methylcarbamoyl]-5-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-[(2-cyclopentyloxyphenyl)methylcarbamoyl]-5-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122122322 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 1-[(2-cyclopentyloxyphenyl)methylcarbamoyl]-5-methylpiperidine-3-carboxylic acid |
| SMILES | CC1CC(C(=O)O)CN(C(=O)NCc2ccccc2OC2CCCC2)C1 |
| InChI | InChI=1S/C20H28N2O4/c1-14-10-16(19(23)24)13-22(12-14)20(25)21-11-15-6-2-5-9-18(15)26-17-7-3-4-8-17/h2,5-6,9,14,16-17H,3-4,7-8,10-13H2,1H3,(H,21,25)(H,23,24) |
| InChIKey | IZORJBZJNPQUAL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |