C13H15BrFN3O2 — CID 94650730
(3R)-1-N-[(2-bromo-5-fluorophenyl)methyl]pyrrolidine-1,3-dicarboxamide (PubChem CID 94650730) has the molecular formula C13H15BrFN3O2 and a molecular weight of 344.18 g/mol. Its IUPAC name is (3R)-1-N-[(2-bromo-5-fluorophenyl)methyl]pyrrolidine-1,3-dicarboxamide.
| Compound Name | (3R)-1-N-[(2-bromo-5-fluorophenyl)methyl]pyrrolidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 94650730 |
| Molecular Formula | C13H15BrFN3O2 |
| Molecular Weight | 344.18 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | (3R)-1-N-[(2-bromo-5-fluorophenyl)methyl]pyrrolidine-1,3-dicarboxamide |
| SMILES | NC(=O)[C@@H]1CCN(C(=O)NCc2cc(F)ccc2Br)C1 |
| InChI | InChI=1S/C13H15BrFN3O2/c14-11-2-1-10(15)5-9(11)6-17-13(20)18-4-3-8(7-18)12(16)19/h1-2,5,8H,3-4,6-7H2,(H2,16,19)(H,17,20)/t8-/m1/s1 |
| InChIKey | SBEKTCJAXVKXGE-MRVPVSSYSA-N |
| XLogP | 1.61 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.18 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |