C13H16BrFN2O2 — CID 111443782
N-[(2-bromo-5-fluorophenyl)methyl]-3-(hydroxymethyl)pyrrolidine-1-carboxamide (PubChem CID 111443782) has the molecular formula C13H16BrFN2O2 and a molecular weight of 331.19 g/mol. Its IUPAC name is N-[(2-bromo-5-fluorophenyl)methyl]-3-(hydroxymethyl)pyrrolidine-1-carboxamide.
| Compound Name | N-[(2-bromo-5-fluorophenyl)methyl]-3-(hydroxymethyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 111443782 |
| Molecular Formula | C13H16BrFN2O2 |
| Molecular Weight | 331.19 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | N-[(2-bromo-5-fluorophenyl)methyl]-3-(hydroxymethyl)pyrrolidine-1-carboxamide |
| SMILES | O=C(NCc1cc(F)ccc1Br)N1CCC(CO)C1 |
| InChI | InChI=1S/C13H16BrFN2O2/c14-12-2-1-11(15)5-10(12)6-16-13(19)17-4-3-9(7-17)8-18/h1-2,5,9,18H,3-4,6-8H2,(H,16,19) |
| InChIKey | CSNILLNMLPYSJW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.19 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |