C31H42N2O3 — CID 143214345
6-[4-[2-(aminomethyl)phenyl]-3-cyclohex-2-en-1-yloxyphenyl]-6-methyl-1-morpholin-4-ylheptan-1-one (PubChem CID 143214345) has the molecular formula C31H42N2O3 and a molecular weight of 490.69 g/mol. Its IUPAC name is 6-[4-[2-(aminomethyl)phenyl]-3-cyclohex-2-en-1-yloxyphenyl]-6-methyl-1-morpholin-4-ylheptan-1-one.
| Compound Name | 6-[4-[2-(aminomethyl)phenyl]-3-cyclohex-2-en-1-yloxyphenyl]-6-methyl-1-morpholin-4-ylheptan-1-one |
|---|---|
| PubChem CID | 143214345 |
| Molecular Formula | C31H42N2O3 |
| Molecular Weight | 490.69 g/mol |
| Exact Mass | 490.32 |
| IUPAC Name | 6-[4-[2-(aminomethyl)phenyl]-3-cyclohex-2-en-1-yloxyphenyl]-6-methyl-1-morpholin-4-ylheptan-1-one |
| SMILES | CC(C)(CCCCC(=O)N1CCOCC1)c1ccc(-c2ccccc2CN)c(OC2C=CCCC2)c1 |
| InChI | InChI=1S/C31H42N2O3/c1-31(2,17-9-8-14-30(34)33-18-20-35-21-19-33)25-15-16-28(27-13-7-6-10-24(27)23-32)29(22-25)36-26-11-4-3-5-12-26/h4,6-7,10-11,13,15-16,22,26H,3,5,8-9,12,14,17-21,23,32H2,1-2H3 |
| InChIKey | RHBJUPJWNNIKLM-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.69 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|