C21H33NO — CID 15571562
2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-5-(2-methyloctan-2-yl)phenol (PubChem CID 15571562) has the molecular formula C21H33NO and a molecular weight of 315.50 g/mol. Its IUPAC name is 2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-5-(2-methyloctan-2-yl)phenol.
| Compound Name | 2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-5-(2-methyloctan-2-yl)phenol |
|---|---|
| PubChem CID | 15571562 |
| Molecular Formula | C21H33NO |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.26 |
| IUPAC Name | 2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-5-(2-methyloctan-2-yl)phenol |
| SMILES | CCCCCCC(C)(C)c1ccc(C2=CCCN(C)C2)c(O)c1 |
| InChI | InChI=1S/C21H33NO/c1-5-6-7-8-13-21(2,3)18-11-12-19(20(23)15-18)17-10-9-14-22(4)16-17/h10-12,15,23H,5-9,13-14,16H2,1-4H3 |
| InChIKey | UGFWCXQBTKWTNB-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|