C23H33FO4 — CID 177067661
[5-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-fluoro-4-hydroxy-6-oxo-2-pentylcyclohexa-2,4-dien-1-yl] acetate (PubChem CID 177067661) has the molecular formula C23H33FO4 and a molecular weight of 392.51 g/mol. Its IUPAC name is [5-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-fluoro-4-hydroxy-6-oxo-2-pentylcyclohexa-2,4-dien-1-yl] acetate.
| Compound Name | [5-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-fluoro-4-hydroxy-6-oxo-2-pentylcyclohexa-2,4-dien-1-yl] acetate |
|---|---|
| PubChem CID | 177067661 |
| Molecular Formula | C23H33FO4 |
| Molecular Weight | 392.51 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | [5-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-fluoro-4-hydroxy-6-oxo-2-pentylcyclohexa-2,4-dien-1-yl] acetate |
| SMILES | CCCCCC1=C(F)C(O)=C(C/C=C(\C)CCC=C(C)C)C(=O)C1OC(C)=O |
| InChI | InChI=1S/C23H33FO4/c1-6-7-8-12-18-20(24)21(26)19(22(27)23(18)28-17(5)25)14-13-16(4)11-9-10-15(2)3/h10,13,23,26H,6-9,11-12,14H2,1-5H3/b16-13+ |
| InChIKey | SLNSWYCBVJSSSP-DTQAZKPQSA-N |
| XLogP | 6.20 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.51 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|