C26H41NO3 — CID 123162823
3-[(2E)-3,7-dimethylocta-2,6-dienyl]-6-pentyl-5-(pentylideneamino)benzene-1,2,4-triol (PubChem CID 123162823) has the molecular formula C26H41NO3 and a molecular weight of 415.62 g/mol. Its IUPAC name is 3-[(2E)-3,7-dimethylocta-2,6-dienyl]-6-pentyl-5-(pentylideneamino)benzene-1,2,4-triol.
| Compound Name | 3-[(2E)-3,7-dimethylocta-2,6-dienyl]-6-pentyl-5-(pentylideneamino)benzene-1,2,4-triol |
|---|---|
| PubChem CID | 123162823 |
| Molecular Formula | C26H41NO3 |
| Molecular Weight | 415.62 g/mol |
| Exact Mass | 415.31 |
| IUPAC Name | 3-[(2E)-3,7-dimethylocta-2,6-dienyl]-6-pentyl-5-(pentylideneamino)benzene-1,2,4-triol |
| SMILES | CCCC/C=N/c1c(O)c(C/C=C(\C)CCC=C(C)C)c(O)c(O)c1CCCCC |
| InChI | InChI=1S/C26H41NO3/c1-6-8-10-15-21-23(27-18-11-9-7-2)24(28)22(26(30)25(21)29)17-16-20(5)14-12-13-19(3)4/h13,16,18,28-30H,6-12,14-15,17H2,1-5H3/b20-16+,27-18+ |
| InChIKey | GJRZEDSXFDJZLI-PYQWSKLRSA-N |
| XLogP | 7.66 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.62 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|