C27H32O7 — CID 163189698
(2R,3R)-6-[(3E)-4,8-dimethylnona-3,7-dienyl]-3,5,7-trihydroxy-2-(4-hydroxy-3-methoxyphenyl)-2,3-dihydrochromen-4-one (PubChem CID 163189698) has the molecular formula C27H32O7 and a molecular weight of 468.55 g/mol. Its IUPAC name is (2R,3R)-6-[(3E)-4,8-dimethylnona-3,7-dienyl]-3,5,7-trihydroxy-2-(4-hydroxy-3-methoxyphenyl)-2,3-dihydrochromen-4-one.
| Compound Name | (2R,3R)-6-[(3E)-4,8-dimethylnona-3,7-dienyl]-3,5,7-trihydroxy-2-(4-hydroxy-3-methoxyphenyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 163189698 |
| Molecular Formula | C27H32O7 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | (2R,3R)-6-[(3E)-4,8-dimethylnona-3,7-dienyl]-3,5,7-trihydroxy-2-(4-hydroxy-3-methoxyphenyl)-2,3-dihydrochromen-4-one |
| SMILES | COc1cc([C@H]2Oc3cc(O)c(CC/C=C(\C)CCC=C(C)C)c(O)c3C(=O)[C@@H]2O)ccc1O |
| InChI | InChI=1S/C27H32O7/c1-15(2)7-5-8-16(3)9-6-10-18-20(29)14-22-23(24(18)30)25(31)26(32)27(34-22)17-11-12-19(28)21(13-17)33-4/h7,9,11-14,26-30,32H,5-6,8,10H2,1-4H3/b16-9+/t26-,27+/m0/s1 |
| InChIKey | CHOUJSUOMJWGDF-QTUDOZFYSA-N |
| XLogP | 5.11 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|