C25H30O8 — CID 74326242
2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-6-(7-hydroxy-3,7-dimethyloct-2-enyl)-2,3-dihydrochromen-4-one (PubChem CID 74326242) has the molecular formula C25H30O8 and a molecular weight of 458.51 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-6-(7-hydroxy-3,7-dimethyloct-2-enyl)-2,3-dihydrochromen-4-one.
| Compound Name | 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-6-(7-hydroxy-3,7-dimethyloct-2-enyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 74326242 |
| Molecular Formula | C25H30O8 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-6-(7-hydroxy-3,7-dimethyloct-2-enyl)-2,3-dihydrochromen-4-one |
| SMILES | CC(=CCc1c(O)cc2c(c1O)C(=O)C(O)C(c1ccc(O)c(O)c1)O2)CCCC(C)(C)O |
| InChI | InChI=1S/C25H30O8/c1-13(5-4-10-25(2,3)32)6-8-15-17(27)12-19-20(21(15)29)22(30)23(31)24(33-19)14-7-9-16(26)18(28)11-14/h6-7,9,11-12,23-24,26-29,31-32H,4-5,8,10H2,1-3H3 |
| InChIKey | OHYMZQLTIUUBFN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|