C16H14O3 — CID 71334768
1-(2,5-dihydroxyphenyl)-3-(4-methylphenyl)prop-2-en-1-one (PubChem CID 71334768) has the molecular formula C16H14O3 and a molecular weight of 254.28 g/mol. Its IUPAC name is 1-(2,5-dihydroxyphenyl)-3-(4-methylphenyl)prop-2-en-1-one.
| Compound Name | 1-(2,5-dihydroxyphenyl)-3-(4-methylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 71334768 |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 1-(2,5-dihydroxyphenyl)-3-(4-methylphenyl)prop-2-en-1-one |
| SMILES | Cc1ccc(C=CC(=O)c2cc(O)ccc2O)cc1 |
| InChI | InChI=1S/C16H14O3/c1-11-2-4-12(5-3-11)6-8-15(18)14-10-13(17)7-9-16(14)19/h2-10,17,19H,1H3 |
| InChIKey | PIAFOKMPUZJORF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|