C23H28O4 — CID 11417320
(E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-1-(2,5-dihydroxyphenyl)prop-2-en-1-one (PubChem CID 11417320) has the molecular formula C23H28O4 and a molecular weight of 368.47 g/mol. Its IUPAC name is (E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-1-(2,5-dihydroxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-1-(2,5-dihydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 11417320 |
| Molecular Formula | C23H28O4 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | (E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-1-(2,5-dihydroxyphenyl)prop-2-en-1-one |
| SMILES | CC(C)(C)c1cc(/C=C/C(=O)c2cc(O)ccc2O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C23H28O4/c1-22(2,3)17-11-14(12-18(21(17)27)23(4,5)6)7-9-19(25)16-13-15(24)8-10-20(16)26/h7-13,24,26-27H,1-6H3/b9-7+ |
| InChIKey | KMUHGKLQLHTOMN-VQHVLOKHSA-N |
| XLogP | 5.29 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|