C21H22O6 — CID 11485512
2-[4-[(E)-3-(2,5-dihydroxyphenyl)-3-oxoprop-1-enyl]-2,6-dimethylphenoxy]-2-methylpropanoic acid (PubChem CID 11485512) has the molecular formula C21H22O6 and a molecular weight of 370.40 g/mol. Its IUPAC name is 2-[4-[(E)-3-(2,5-dihydroxyphenyl)-3-oxoprop-1-enyl]-2,6-dimethylphenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[4-[(E)-3-(2,5-dihydroxyphenyl)-3-oxoprop-1-enyl]-2,6-dimethylphenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 11485512 |
| Molecular Formula | C21H22O6 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 2-[4-[(E)-3-(2,5-dihydroxyphenyl)-3-oxoprop-1-enyl]-2,6-dimethylphenoxy]-2-methylpropanoic acid |
| SMILES | Cc1cc(/C=C/C(=O)c2cc(O)ccc2O)cc(C)c1OC(C)(C)C(=O)O |
| InChI | InChI=1S/C21H22O6/c1-12-9-14(10-13(2)19(12)27-21(3,4)20(25)26)5-7-17(23)16-11-15(22)6-8-18(16)24/h5-11,22,24H,1-4H3,(H,25,26)/b7-5+ |
| InChIKey | QZLPTPIXQXTAPV-FNORWQNLSA-N |
| XLogP | 3.85 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|