C26H27NO6 — CID 142599782
2-[4-[(E)-3-(2,7-dimethoxyquinolin-3-yl)-3-oxoprop-1-enyl]-2,6-dimethylphenoxy]-2-methylpropanoic acid (PubChem CID 142599782) has the molecular formula C26H27NO6 and a molecular weight of 449.50 g/mol. Its IUPAC name is 2-[4-[(E)-3-(2,7-dimethoxyquinolin-3-yl)-3-oxoprop-1-enyl]-2,6-dimethylphenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[4-[(E)-3-(2,7-dimethoxyquinolin-3-yl)-3-oxoprop-1-enyl]-2,6-dimethylphenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 142599782 |
| Molecular Formula | C26H27NO6 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | 2-[4-[(E)-3-(2,7-dimethoxyquinolin-3-yl)-3-oxoprop-1-enyl]-2,6-dimethylphenoxy]-2-methylpropanoic acid |
| SMILES | COc1ccc2cc(C(=O)/C=C/c3cc(C)c(OC(C)(C)C(=O)O)c(C)c3)c(OC)nc2c1 |
| InChI | InChI=1S/C26H27NO6/c1-15-11-17(12-16(2)23(15)33-26(3,4)25(29)30)7-10-22(28)20-13-18-8-9-19(31-5)14-21(18)27-24(20)32-6/h7-14H,1-6H3,(H,29,30)/b10-7+ |
| InChIKey | MBYJQOCBWHXGFD-JXMROGBWSA-N |
| XLogP | 5.01 |
| TPSA | 94.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|