C21H21IO4 — CID 91602280
2-[4-[3-(4-iodophenyl)-3-oxoprop-1-enyl]-2,6-dimethylphenoxy]-2-methylpropanoic acid (PubChem CID 91602280) has the molecular formula C21H21IO4 and a molecular weight of 464.30 g/mol. Its IUPAC name is 2-[4-[3-(4-iodophenyl)-3-oxoprop-1-enyl]-2,6-dimethylphenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[4-[3-(4-iodophenyl)-3-oxoprop-1-enyl]-2,6-dimethylphenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 91602280 |
| Molecular Formula | C21H21IO4 |
| Molecular Weight | 464.30 g/mol |
| Exact Mass | 464.05 |
| IUPAC Name | 2-[4-[3-(4-iodophenyl)-3-oxoprop-1-enyl]-2,6-dimethylphenoxy]-2-methylpropanoic acid |
| SMILES | Cc1cc(C=CC(=O)c2ccc(I)cc2)cc(C)c1OC(C)(C)C(=O)O |
| InChI | InChI=1S/C21H21IO4/c1-13-11-15(5-10-18(23)16-6-8-17(22)9-7-16)12-14(2)19(13)26-21(3,4)20(24)25/h5-12H,1-4H3,(H,24,25) |
| InChIKey | BPOIHKAUBBZALJ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.30 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|