C18H17IO4 — CID 11101941
(E)-3-(3,4-dimethoxyphenyl)-1-(2-hydroxy-3-iodo-5-methylphenyl)prop-2-en-1-one (PubChem CID 11101941) has the molecular formula C18H17IO4 and a molecular weight of 424.23 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-1-(2-hydroxy-3-iodo-5-methylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-1-(2-hydroxy-3-iodo-5-methylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 11101941 |
| Molecular Formula | C18H17IO4 |
| Molecular Weight | 424.23 g/mol |
| Exact Mass | 424.02 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-1-(2-hydroxy-3-iodo-5-methylphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2cc(C)cc(I)c2O)cc1OC |
| InChI | InChI=1S/C18H17IO4/c1-11-8-13(18(21)14(19)9-11)15(20)6-4-12-5-7-16(22-2)17(10-12)23-3/h4-10,21H,1-3H3/b6-4+ |
| InChIKey | YHFRPRHRHMKJRB-GQCTYLIASA-N |
| XLogP | 4.22 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.23 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|