C18H16ClIO4 — CID 11762266
(E)-1-(5-chloro-2-hydroxy-3-iodo-4-methylphenyl)-3-(3,4-dimethoxyphenyl)prop-2-en-1-one (PubChem CID 11762266) has the molecular formula C18H16ClIO4 and a molecular weight of 458.68 g/mol. Its IUPAC name is (E)-1-(5-chloro-2-hydroxy-3-iodo-4-methylphenyl)-3-(3,4-dimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(5-chloro-2-hydroxy-3-iodo-4-methylphenyl)-3-(3,4-dimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 11762266 |
| Molecular Formula | C18H16ClIO4 |
| Molecular Weight | 458.68 g/mol |
| Exact Mass | 457.98 |
| IUPAC Name | (E)-1-(5-chloro-2-hydroxy-3-iodo-4-methylphenyl)-3-(3,4-dimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2cc(Cl)c(C)c(I)c2O)cc1OC |
| InChI | InChI=1S/C18H16ClIO4/c1-10-13(19)9-12(18(22)17(10)20)14(21)6-4-11-5-7-15(23-2)16(8-11)24-3/h4-9,22H,1-3H3/b6-4+ |
| InChIKey | OUJAVCRNVMIJOW-GQCTYLIASA-N |
| XLogP | 4.87 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.68 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|