C19H17NO4S — CID 16724847
5-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enoyl]-6-methoxy-1,3-benzoxathiol-2-one (PubChem CID 16724847) has the molecular formula C19H17NO4S and a molecular weight of 355.42 g/mol. Its IUPAC name is 5-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enoyl]-6-methoxy-1,3-benzoxathiol-2-one.
| Compound Name | 5-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enoyl]-6-methoxy-1,3-benzoxathiol-2-one |
|---|---|
| PubChem CID | 16724847 |
| Molecular Formula | C19H17NO4S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 5-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enoyl]-6-methoxy-1,3-benzoxathiol-2-one |
| SMILES | COc1cc2oc(=O)sc2cc1C(=O)/C=C/c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C19H17NO4S/c1-20(2)13-7-4-12(5-8-13)6-9-15(21)14-10-18-17(11-16(14)23-3)24-19(22)25-18/h4-11H,1-3H3/b9-6+ |
| InChIKey | MZCUBRZNJDOPDB-RMKNXTFCSA-N |
| XLogP | 3.83 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|