C18H15BrO3S — CID 66871760
3-(4-bromophenyl)-1-(7-methoxy-2,3-dihydro-1,4-benzoxathiin-6-yl)prop-2-en-1-one (PubChem CID 66871760) has the molecular formula C18H15BrO3S and a molecular weight of 391.29 g/mol. Its IUPAC name is 3-(4-bromophenyl)-1-(7-methoxy-2,3-dihydro-1,4-benzoxathiin-6-yl)prop-2-en-1-one.
| Compound Name | 3-(4-bromophenyl)-1-(7-methoxy-2,3-dihydro-1,4-benzoxathiin-6-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 66871760 |
| Molecular Formula | C18H15BrO3S |
| Molecular Weight | 391.29 g/mol |
| Exact Mass | 389.99 |
| IUPAC Name | 3-(4-bromophenyl)-1-(7-methoxy-2,3-dihydro-1,4-benzoxathiin-6-yl)prop-2-en-1-one |
| SMILES | COc1cc2c(cc1C(=O)C=Cc1ccc(Br)cc1)SCCO2 |
| InChI | InChI=1S/C18H15BrO3S/c1-21-16-11-17-18(23-9-8-22-17)10-14(16)15(20)7-4-12-2-5-13(19)6-3-12/h2-7,10-11H,8-9H2,1H3 |
| InChIKey | PIMUTKAMNFUXBO-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.29 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|